C14H8Cl4N2 — CID 82029741
6-chloro-3-(chloromethyl)-2-(2,4-dichlorophenyl)imidazo[1,2-a]pyridine (PubChem CID 82029741) has the molecular formula C14H8Cl4N2 and a molecular weight of 346.04 g/mol. Its IUPAC name is 6-chloro-3-(chloromethyl)-2-(2,4-dichlorophenyl)imidazo[1,2-a]pyridine.
| Compound Name | 6-chloro-3-(chloromethyl)-2-(2,4-dichlorophenyl)imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 82029741 |
| Molecular Formula | C14H8Cl4N2 |
| Molecular Weight | 346.04 g/mol |
| Exact Mass | 343.94 |
| IUPAC Name | 6-chloro-3-(chloromethyl)-2-(2,4-dichlorophenyl)imidazo[1,2-a]pyridine |
| SMILES | ClCc1c(-c2ccc(Cl)cc2Cl)nc2ccc(Cl)cn12 |
| InChI | InChI=1S/C14H8Cl4N2/c15-6-12-14(10-3-1-8(16)5-11(10)18)19-13-4-2-9(17)7-20(12)13/h1-5,7H,6H2 |
| InChIKey | BFUBJIZIEHBGCT-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.04 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|