C18H19Cl2N3 — CID 69338112
N-butyl-2-(2,4-dichlorophenyl)-6-methylimidazo[1,2-a]pyridin-3-amine (PubChem CID 69338112) has the molecular formula C18H19Cl2N3 and a molecular weight of 348.28 g/mol. Its IUPAC name is N-butyl-2-(2,4-dichlorophenyl)-6-methylimidazo[1,2-a]pyridin-3-amine.
| Compound Name | N-butyl-2-(2,4-dichlorophenyl)-6-methylimidazo[1,2-a]pyridin-3-amine |
|---|---|
| PubChem CID | 69338112 |
| Molecular Formula | C18H19Cl2N3 |
| Molecular Weight | 348.28 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | N-butyl-2-(2,4-dichlorophenyl)-6-methylimidazo[1,2-a]pyridin-3-amine |
| SMILES | CCCCNc1c(-c2ccc(Cl)cc2Cl)nc2ccc(C)cn12 |
| InChI | InChI=1S/C18H19Cl2N3/c1-3-4-9-21-18-17(14-7-6-13(19)10-15(14)20)22-16-8-5-12(2)11-23(16)18/h5-8,10-11,21H,3-4,9H2,1-2H3 |
| InChIKey | LAMOQYYNQMSDFZ-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.28 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|