C16H13Cl3N2 — CID 82029820
3-(1-chloroethyl)-2-(2,4-dichlorophenyl)-6-methylimidazo[1,2-a]pyridine (PubChem CID 82029820) has the molecular formula C16H13Cl3N2 and a molecular weight of 339.65 g/mol. Its IUPAC name is 3-(1-chloroethyl)-2-(2,4-dichlorophenyl)-6-methylimidazo[1,2-a]pyridine.
| Compound Name | 3-(1-chloroethyl)-2-(2,4-dichlorophenyl)-6-methylimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 82029820 |
| Molecular Formula | C16H13Cl3N2 |
| Molecular Weight | 339.65 g/mol |
| Exact Mass | 338.01 |
| IUPAC Name | 3-(1-chloroethyl)-2-(2,4-dichlorophenyl)-6-methylimidazo[1,2-a]pyridine |
| SMILES | Cc1ccc2nc(-c3ccc(Cl)cc3Cl)c(C(C)Cl)n2c1 |
| InChI | InChI=1S/C16H13Cl3N2/c1-9-3-6-14-20-15(16(10(2)17)21(14)8-9)12-5-4-11(18)7-13(12)19/h3-8,10H,1-2H3 |
| InChIKey | UBHRTJPXDYPMPL-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.65 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|