C18H19ClN2 — CID 82029815
3-(1-chloroethyl)-2-(4-ethylphenyl)-6-methylimidazo[1,2-a]pyridine (PubChem CID 82029815) has the molecular formula C18H19ClN2 and a molecular weight of 298.82 g/mol. Its IUPAC name is 3-(1-chloroethyl)-2-(4-ethylphenyl)-6-methylimidazo[1,2-a]pyridine.
| Compound Name | 3-(1-chloroethyl)-2-(4-ethylphenyl)-6-methylimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 82029815 |
| Molecular Formula | C18H19ClN2 |
| Molecular Weight | 298.82 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 3-(1-chloroethyl)-2-(4-ethylphenyl)-6-methylimidazo[1,2-a]pyridine |
| SMILES | CCc1ccc(-c2nc3ccc(C)cn3c2C(C)Cl)cc1 |
| InChI | InChI=1S/C18H19ClN2/c1-4-14-6-8-15(9-7-14)17-18(13(3)19)21-11-12(2)5-10-16(21)20-17/h5-11,13H,4H2,1-3H3 |
| InChIKey | ZYLAPXYLDYFJIG-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.82 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|