C17H15Cl2N3O — CID 93016902
(2R)-2-chloro-N-[2-(3-chlorophenyl)-6-methylimidazo[1,2-a]pyridin-3-yl]propanamide (PubChem CID 93016902) has the molecular formula C17H15Cl2N3O and a molecular weight of 348.23 g/mol. Its IUPAC name is (2R)-2-chloro-N-[2-(3-chlorophenyl)-6-methylimidazo[1,2-a]pyridin-3-yl]propanamide.
| Compound Name | (2R)-2-chloro-N-[2-(3-chlorophenyl)-6-methylimidazo[1,2-a]pyridin-3-yl]propanamide |
|---|---|
| PubChem CID | 93016902 |
| Molecular Formula | C17H15Cl2N3O |
| Molecular Weight | 348.23 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | (2R)-2-chloro-N-[2-(3-chlorophenyl)-6-methylimidazo[1,2-a]pyridin-3-yl]propanamide |
| SMILES | Cc1ccc2nc(-c3cccc(Cl)c3)c(NC(=O)[C@@H](C)Cl)n2c1 |
| InChI | InChI=1S/C17H15Cl2N3O/c1-10-6-7-14-20-15(12-4-3-5-13(19)8-12)16(22(14)9-10)21-17(23)11(2)18/h3-9,11H,1-2H3,(H,21,23)/t11-/m1/s1 |
| InChIKey | NLUWSNHQTNIGKO-LLVKDONJSA-N |
| XLogP | 4.53 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.23 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|