C23H20ClN3O2 — CID 42693897
2-chloro-N-[2-(2-methoxyphenyl)-6-methylimidazo[1,2-a]pyridin-3-yl]-2-phenylacetamide (PubChem CID 42693897) has the molecular formula C23H20ClN3O2 and a molecular weight of 405.89 g/mol. Its IUPAC name is 2-chloro-N-[2-(2-methoxyphenyl)-6-methylimidazo[1,2-a]pyridin-3-yl]-2-phenylacetamide.
| Compound Name | 2-chloro-N-[2-(2-methoxyphenyl)-6-methylimidazo[1,2-a]pyridin-3-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 42693897 |
| Molecular Formula | C23H20ClN3O2 |
| Molecular Weight | 405.89 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | 2-chloro-N-[2-(2-methoxyphenyl)-6-methylimidazo[1,2-a]pyridin-3-yl]-2-phenylacetamide |
| SMILES | COc1ccccc1-c1nc2ccc(C)cn2c1NC(=O)C(Cl)c1ccccc1 |
| InChI | InChI=1S/C23H20ClN3O2/c1-15-12-13-19-25-21(17-10-6-7-11-18(17)29-2)22(27(19)14-15)26-23(28)20(24)16-8-4-3-5-9-16/h3-14,20H,1-2H3,(H,26,28) |
| InChIKey | UHPGPKXDLUGALP-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.89 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|