C17H15Cl2N3O2 — CID 42693842
2,2-dichloro-N-[2-(2-methoxyphenyl)-7-methylimidazo[1,2-a]pyridin-3-yl]acetamide (PubChem CID 42693842) has the molecular formula C17H15Cl2N3O2 and a molecular weight of 364.23 g/mol. Its IUPAC name is 2,2-dichloro-N-[2-(2-methoxyphenyl)-7-methylimidazo[1,2-a]pyridin-3-yl]acetamide.
| Compound Name | 2,2-dichloro-N-[2-(2-methoxyphenyl)-7-methylimidazo[1,2-a]pyridin-3-yl]acetamide |
|---|---|
| PubChem CID | 42693842 |
| Molecular Formula | C17H15Cl2N3O2 |
| Molecular Weight | 364.23 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | 2,2-dichloro-N-[2-(2-methoxyphenyl)-7-methylimidazo[1,2-a]pyridin-3-yl]acetamide |
| SMILES | COc1ccccc1-c1nc2cc(C)ccn2c1NC(=O)C(Cl)Cl |
| InChI | InChI=1S/C17H15Cl2N3O2/c1-10-7-8-22-13(9-10)20-14(16(22)21-17(23)15(18)19)11-5-3-4-6-12(11)24-2/h3-9,15H,1-2H3,(H,21,23) |
| InChIKey | AXZQIZUFFCAOSH-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.23 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|