C19H20ClN3O3 — CID 93016814
(2R)-2-chloro-N-[2-(3,4-dimethoxyphenyl)-7-methylimidazo[1,2-a]pyridin-3-yl]propanamide (PubChem CID 93016814) has the molecular formula C19H20ClN3O3 and a molecular weight of 373.84 g/mol. Its IUPAC name is (2R)-2-chloro-N-[2-(3,4-dimethoxyphenyl)-7-methylimidazo[1,2-a]pyridin-3-yl]propanamide.
| Compound Name | (2R)-2-chloro-N-[2-(3,4-dimethoxyphenyl)-7-methylimidazo[1,2-a]pyridin-3-yl]propanamide |
|---|---|
| PubChem CID | 93016814 |
| Molecular Formula | C19H20ClN3O3 |
| Molecular Weight | 373.84 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | (2R)-2-chloro-N-[2-(3,4-dimethoxyphenyl)-7-methylimidazo[1,2-a]pyridin-3-yl]propanamide |
| SMILES | COc1ccc(-c2nc3cc(C)ccn3c2NC(=O)[C@@H](C)Cl)cc1OC |
| InChI | InChI=1S/C19H20ClN3O3/c1-11-7-8-23-16(9-11)21-17(18(23)22-19(24)12(2)20)13-5-6-14(25-3)15(10-13)26-4/h5-10,12H,1-4H3,(H,22,24)/t12-/m1/s1 |
| InChIKey | WBIMPWWSDVSYTE-GFCCVEGCSA-N |
| XLogP | 3.89 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.84 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|