C19H17N2O4- — CID 7023668
(E)-3-[2-(3,4-dimethoxyphenyl)-7-methylimidazo[1,2-a]pyridin-3-yl]prop-2-enoate (PubChem CID 7023668) has the molecular formula C19H17N2O4- and a molecular weight of 337.36 g/mol. Its IUPAC name is (E)-3-[2-(3,4-dimethoxyphenyl)-7-methylimidazo[1,2-a]pyridin-3-yl]prop-2-enoate.
| Compound Name | (E)-3-[2-(3,4-dimethoxyphenyl)-7-methylimidazo[1,2-a]pyridin-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 7023668 |
| Molecular Formula | C19H17N2O4- |
| Molecular Weight | 337.36 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | (E)-3-[2-(3,4-dimethoxyphenyl)-7-methylimidazo[1,2-a]pyridin-3-yl]prop-2-enoate |
| SMILES | COc1ccc(-c2nc3cc(C)ccn3c2/C=C/C(=O)[O-])cc1OC |
| InChI | InChI=1S/C19H18N2O4/c1-12-8-9-21-14(5-7-18(22)23)19(20-17(21)10-12)13-4-6-15(24-2)16(11-13)25-3/h4-11H,1-3H3,(H,22,23)/p-1/b7-5+ |
| InChIKey | GTMWZZBAUINJPT-FNORWQNLSA-M |
| XLogP | 2.09 |
| TPSA | 75.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.36 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|