C23H17N2O2- — CID 7023742
(E)-3-[6-methyl-2-(4-phenylphenyl)imidazo[1,2-a]pyridin-3-yl]prop-2-enoate (PubChem CID 7023742) has the molecular formula C23H17N2O2- and a molecular weight of 353.40 g/mol. Its IUPAC name is (E)-3-[6-methyl-2-(4-phenylphenyl)imidazo[1,2-a]pyridin-3-yl]prop-2-enoate.
| Compound Name | (E)-3-[6-methyl-2-(4-phenylphenyl)imidazo[1,2-a]pyridin-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 7023742 |
| Molecular Formula | C23H17N2O2- |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | (E)-3-[6-methyl-2-(4-phenylphenyl)imidazo[1,2-a]pyridin-3-yl]prop-2-enoate |
| SMILES | Cc1ccc2nc(-c3ccc(-c4ccccc4)cc3)c(/C=C/C(=O)[O-])n2c1 |
| InChI | InChI=1S/C23H18N2O2/c1-16-7-13-21-24-23(20(25(21)15-16)12-14-22(26)27)19-10-8-18(9-11-19)17-5-3-2-4-6-17/h2-15H,1H3,(H,26,27)/p-1/b14-12+ |
| InChIKey | UUACRNGJWLCEQO-WYMLVPIESA-M |
| XLogP | 3.74 |
| TPSA | 57.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|