C17H12ClN2O3- — CID 7023768
(E)-3-[6-chloro-2-(3-methoxyphenyl)imidazo[1,2-a]pyridin-3-yl]prop-2-enoate (PubChem CID 7023768) has the molecular formula C17H12ClN2O3- and a molecular weight of 327.75 g/mol. Its IUPAC name is (E)-3-[6-chloro-2-(3-methoxyphenyl)imidazo[1,2-a]pyridin-3-yl]prop-2-enoate.
| Compound Name | (E)-3-[6-chloro-2-(3-methoxyphenyl)imidazo[1,2-a]pyridin-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 7023768 |
| Molecular Formula | C17H12ClN2O3- |
| Molecular Weight | 327.75 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | (E)-3-[6-chloro-2-(3-methoxyphenyl)imidazo[1,2-a]pyridin-3-yl]prop-2-enoate |
| SMILES | COc1cccc(-c2nc3ccc(Cl)cn3c2/C=C/C(=O)[O-])c1 |
| InChI | InChI=1S/C17H13ClN2O3/c1-23-13-4-2-3-11(9-13)17-14(6-8-16(21)22)20-10-12(18)5-7-15(20)19-17/h2-10H,1H3,(H,21,22)/p-1/b8-6+ |
| InChIKey | SZWQLLXQVMXVMA-SOFGYWHQSA-M |
| XLogP | 2.43 |
| TPSA | 66.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.75 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|