C29H22N2O — CID 15321695
(Z)-3-(6-methyl-2-phenylimidazo[1,2-a]pyridin-3-yl)-1,3-diphenylprop-2-en-1-one (PubChem CID 15321695) has the molecular formula C29H22N2O and a molecular weight of 414.51 g/mol. Its IUPAC name is (Z)-3-(6-methyl-2-phenylimidazo[1,2-a]pyridin-3-yl)-1,3-diphenylprop-2-en-1-one.
| Compound Name | (Z)-3-(6-methyl-2-phenylimidazo[1,2-a]pyridin-3-yl)-1,3-diphenylprop-2-en-1-one |
|---|---|
| PubChem CID | 15321695 |
| Molecular Formula | C29H22N2O |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | (Z)-3-(6-methyl-2-phenylimidazo[1,2-a]pyridin-3-yl)-1,3-diphenylprop-2-en-1-one |
| SMILES | Cc1ccc2nc(-c3ccccc3)c(/C(=C\C(=O)c3ccccc3)c3ccccc3)n2c1 |
| InChI | InChI=1S/C29H22N2O/c1-21-17-18-27-30-28(24-15-9-4-10-16-24)29(31(27)20-21)25(22-11-5-2-6-12-22)19-26(32)23-13-7-3-8-14-23/h2-20H,1H3/b25-19- |
| InChIKey | DCCRCJFIOHGXJZ-PLRJNAJWSA-N |
| XLogP | 6.62 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|