C16H12ClFIN2O- — CID 163800953
2-[6-chloro-2-(4-fluorophenyl)imidazo[1,2-a]pyridin-3-yl]-1-methyliodanuidylethanone (PubChem CID 163800953) has the molecular formula C16H12ClFIN2O- and a molecular weight of 429.64 g/mol. Its IUPAC name is 2-[6-chloro-2-(4-fluorophenyl)imidazo[1,2-a]pyridin-3-yl]-1-methyliodanuidylethanone.
| Compound Name | 2-[6-chloro-2-(4-fluorophenyl)imidazo[1,2-a]pyridin-3-yl]-1-methyliodanuidylethanone |
|---|---|
| PubChem CID | 163800953 |
| Molecular Formula | C16H12ClFIN2O- |
| Molecular Weight | 429.64 g/mol |
| Exact Mass | 428.97 |
| IUPAC Name | 2-[6-chloro-2-(4-fluorophenyl)imidazo[1,2-a]pyridin-3-yl]-1-methyliodanuidylethanone |
| SMILES | C[I-]C(=O)Cc1c(-c2ccc(F)cc2)nc2ccc(Cl)cn12 |
| InChI | InChI=1S/C16H12ClFIN2O/c1-19-14(22)8-13-16(10-2-5-12(18)6-3-10)20-15-7-4-11(17)9-21(13)15/h2-7,9H,8H2,1H3/q-1 |
| InChIKey | VZQHQIQFHGXDAI-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.64 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|