C14H11ClN4S — CID 39134128
2-(6-chloro-2-pyridin-4-ylimidazo[1,2-a]pyridin-3-yl)ethanethioamide (PubChem CID 39134128) has the molecular formula C14H11ClN4S and a molecular weight of 302.79 g/mol. Its IUPAC name is 2-(6-chloro-2-pyridin-4-ylimidazo[1,2-a]pyridin-3-yl)ethanethioamide.
| Compound Name | 2-(6-chloro-2-pyridin-4-ylimidazo[1,2-a]pyridin-3-yl)ethanethioamide |
|---|---|
| PubChem CID | 39134128 |
| Molecular Formula | C14H11ClN4S |
| Molecular Weight | 302.79 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | 2-(6-chloro-2-pyridin-4-ylimidazo[1,2-a]pyridin-3-yl)ethanethioamide |
| SMILES | NC(=S)Cc1c(-c2ccncc2)nc2ccc(Cl)cn12 |
| InChI | InChI=1S/C14H11ClN4S/c15-10-1-2-13-18-14(9-3-5-17-6-4-9)11(7-12(16)20)19(13)8-10/h1-6,8H,7H2,(H2,16,20) |
| InChIKey | DSVLGZCQKBJGIZ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.79 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|