C18H19N3O — CID 70030368
methyl 2-[7-methyl-2-(4-methylphenyl)imidazo[1,2-a]pyridin-3-yl]ethanimidate (PubChem CID 70030368) has the molecular formula C18H19N3O and a molecular weight of 293.37 g/mol. Its IUPAC name is methyl 2-[7-methyl-2-(4-methylphenyl)imidazo[1,2-a]pyridin-3-yl]ethanimidate.
| Compound Name | methyl 2-[7-methyl-2-(4-methylphenyl)imidazo[1,2-a]pyridin-3-yl]ethanimidate |
|---|---|
| PubChem CID | 70030368 |
| Molecular Formula | C18H19N3O |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | methyl 2-[7-methyl-2-(4-methylphenyl)imidazo[1,2-a]pyridin-3-yl]ethanimidate |
| SMILES | [H]/N=C(/Cc1c(-c2ccc(C)cc2)nc2cc(C)ccn12)OC |
| InChI | InChI=1S/C18H19N3O/c1-12-4-6-14(7-5-12)18-15(11-16(19)22-3)21-9-8-13(2)10-17(21)20-18/h4-10,19H,11H2,1-3H3/b19-16- |
| InChIKey | OXPIFPVZUAIKEX-MNDPQUGUSA-N |
| XLogP | 3.78 |
| TPSA | 50.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|