C26H24N6O3 — CID 158883882
[4-[3-[(1-hydroxyimino-2,3-dihydroinden-5-yl)amino]imidazo[1,2-a]pyrazin-2-yl]phenyl]-morpholin-4-ylmethanone (PubChem CID 158883882) has the molecular formula C26H24N6O3 and a molecular weight of 468.52 g/mol. Its IUPAC name is [4-[3-[(1-hydroxyimino-2,3-dihydroinden-5-yl)amino]imidazo[1,2-a]pyrazin-2-yl]phenyl]-morpholin-4-ylmethanone.
| Compound Name | [4-[3-[(1-hydroxyimino-2,3-dihydroinden-5-yl)amino]imidazo[1,2-a]pyrazin-2-yl]phenyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 158883882 |
| Molecular Formula | C26H24N6O3 |
| Molecular Weight | 468.52 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | [4-[3-[(1-hydroxyimino-2,3-dihydroinden-5-yl)amino]imidazo[1,2-a]pyrazin-2-yl]phenyl]-morpholin-4-ylmethanone |
| SMILES | O=C(c1ccc(-c2nc3cnccn3c2Nc2ccc3c(c2)CCC3=NO)cc1)N1CCOCC1 |
| InChI | InChI=1S/C26H24N6O3/c33-26(31-11-13-35-14-12-31)18-3-1-17(2-4-18)24-25(32-10-9-27-16-23(32)29-24)28-20-6-7-21-19(15-20)5-8-22(21)30-34/h1-4,6-7,9-10,15-16,28,34H,5,8,11-14H2 |
| InChIKey | JDJGQVHPAWPVJC-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 104.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.52 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|