C22H16N6O — CID 135510576
4-[3-[[(1Z)-1-hydroxyimino-2,3-dihydroinden-5-yl]amino]imidazo[1,2-a]pyrazin-2-yl]benzonitrile (PubChem CID 135510576) has the molecular formula C22H16N6O and a molecular weight of 380.41 g/mol. Its IUPAC name is 4-[3-[[(1Z)-1-hydroxyimino-2,3-dihydroinden-5-yl]amino]imidazo[1,2-a]pyrazin-2-yl]benzonitrile.
| Compound Name | 4-[3-[[(1Z)-1-hydroxyimino-2,3-dihydroinden-5-yl]amino]imidazo[1,2-a]pyrazin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 135510576 |
| Molecular Formula | C22H16N6O |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 4-[3-[[(1Z)-1-hydroxyimino-2,3-dihydroinden-5-yl]amino]imidazo[1,2-a]pyrazin-2-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2nc3cnccn3c2Nc2ccc3c(c2)CC/C3=N/O)cc1 |
| InChI | InChI=1S/C22H16N6O/c23-12-14-1-3-15(4-2-14)21-22(28-10-9-24-13-20(28)26-21)25-17-6-7-18-16(11-17)5-8-19(18)27-29/h1-4,6-7,9-11,13,25,29H,5,8H2/b27-19- |
| InChIKey | FCKQHCDUAVMNNK-DIBXZPPDSA-N |
| XLogP | 4.14 |
| TPSA | 98.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|