C24H18N6O — CID 135510599
(NE)-N-[5-[(2-quinolin-2-ylimidazo[1,2-a]pyrazin-3-yl)amino]-2,3-dihydroinden-1-ylidene]hydroxylamine (PubChem CID 135510599) has the molecular formula C24H18N6O and a molecular weight of 406.45 g/mol. Its IUPAC name is (NE)-N-[5-[(2-quinolin-2-ylimidazo[1,2-a]pyrazin-3-yl)amino]-2,3-dihydroinden-1-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[5-[(2-quinolin-2-ylimidazo[1,2-a]pyrazin-3-yl)amino]-2,3-dihydroinden-1-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 135510599 |
| Molecular Formula | C24H18N6O |
| Molecular Weight | 406.45 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | (NE)-N-[5-[(2-quinolin-2-ylimidazo[1,2-a]pyrazin-3-yl)amino]-2,3-dihydroinden-1-ylidene]hydroxylamine |
| SMILES | O/N=C1\CCc2cc(Nc3c(-c4ccc5ccccc5n4)nc4cnccn34)ccc21 |
| InChI | InChI=1S/C24H18N6O/c31-29-20-9-6-16-13-17(7-8-18(16)20)26-24-23(28-22-14-25-11-12-30(22)24)21-10-5-15-3-1-2-4-19(15)27-21/h1-5,7-8,10-14,26,31H,6,9H2/b29-20+ |
| InChIKey | WZVLAQROYSZXOO-ZTKZIYFRSA-N |
| XLogP | 4.81 |
| TPSA | 87.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.45 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|