C21H18N6O — CID 143334422
(NE)-N-[5-[[2-(3H-azepin-7-yl)imidazo[1,2-a]pyrazin-3-yl]amino]-2,3-dihydroinden-1-ylidene]hydroxylamine (PubChem CID 143334422) has the molecular formula C21H18N6O and a molecular weight of 370.42 g/mol. Its IUPAC name is (NE)-N-[5-[[2-(3H-azepin-7-yl)imidazo[1,2-a]pyrazin-3-yl]amino]-2,3-dihydroinden-1-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[5-[[2-(3H-azepin-7-yl)imidazo[1,2-a]pyrazin-3-yl]amino]-2,3-dihydroinden-1-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 143334422 |
| Molecular Formula | C21H18N6O |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | (NE)-N-[5-[[2-(3H-azepin-7-yl)imidazo[1,2-a]pyrazin-3-yl]amino]-2,3-dihydroinden-1-ylidene]hydroxylamine |
| SMILES | O/N=C1\CCc2cc(Nc3c(C4=CC=CCC=N4)nc4cnccn34)ccc21 |
| InChI | InChI=1S/C21H18N6O/c28-26-17-8-5-14-12-15(6-7-16(14)17)24-21-20(18-4-2-1-3-9-23-18)25-19-13-22-10-11-27(19)21/h1-2,4,6-7,9-13,24,28H,3,5,8H2/b26-17+ |
| InChIKey | CUAQYWSEAVJHGW-YZSQISJMSA-N |
| XLogP | 3.97 |
| TPSA | 87.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|