C23H20N6O2 — CID 157197195
N-[4-[3-[(1-hydroxyimino-2,3-dihydroinden-5-yl)amino]imidazo[1,2-a]pyrazin-2-yl]phenyl]acetamide (PubChem CID 157197195) has the molecular formula C23H20N6O2 and a molecular weight of 412.45 g/mol. Its IUPAC name is N-[4-[3-[(1-hydroxyimino-2,3-dihydroinden-5-yl)amino]imidazo[1,2-a]pyrazin-2-yl]phenyl]acetamide.
| Compound Name | N-[4-[3-[(1-hydroxyimino-2,3-dihydroinden-5-yl)amino]imidazo[1,2-a]pyrazin-2-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 157197195 |
| Molecular Formula | C23H20N6O2 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | N-[4-[3-[(1-hydroxyimino-2,3-dihydroinden-5-yl)amino]imidazo[1,2-a]pyrazin-2-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(-c2nc3cnccn3c2Nc2ccc3c(c2)CCC3=NO)cc1 |
| InChI | InChI=1S/C23H20N6O2/c1-14(30)25-17-5-2-15(3-6-17)22-23(29-11-10-24-13-21(29)27-22)26-18-7-8-19-16(12-18)4-9-20(19)28-31/h2-3,5-8,10-13,26,31H,4,9H2,1H3,(H,25,30) |
| InChIKey | NVLXQHRFHCDRDC-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 103.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|