C22H19N7O — CID 135755512
3-[2-[3-[[(1E)-1-hydroxyimino-2,3-dihydroinden-5-yl]amino]imidazo[1,2-a]pyrazin-2-yl]pyrrol-1-yl]propanenitrile (PubChem CID 135755512) has the molecular formula C22H19N7O and a molecular weight of 397.44 g/mol. Its IUPAC name is 3-[2-[3-[[(1E)-1-hydroxyimino-2,3-dihydroinden-5-yl]amino]imidazo[1,2-a]pyrazin-2-yl]pyrrol-1-yl]propanenitrile.
| Compound Name | 3-[2-[3-[[(1E)-1-hydroxyimino-2,3-dihydroinden-5-yl]amino]imidazo[1,2-a]pyrazin-2-yl]pyrrol-1-yl]propanenitrile |
|---|---|
| PubChem CID | 135755512 |
| Molecular Formula | C22H19N7O |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | 3-[2-[3-[[(1E)-1-hydroxyimino-2,3-dihydroinden-5-yl]amino]imidazo[1,2-a]pyrazin-2-yl]pyrrol-1-yl]propanenitrile |
| SMILES | N#CCCn1cccc1-c1nc2cnccn2c1Nc1ccc2c(c1)CC/C2=N\O |
| InChI | InChI=1S/C22H19N7O/c23-8-2-11-28-10-1-3-19(28)21-22(29-12-9-24-14-20(29)26-21)25-16-5-6-17-15(13-16)4-7-18(17)27-30/h1,3,5-6,9-10,12-14,25,30H,2,4,7,11H2/b27-18+ |
| InChIKey | ZKYAFDSFUSOBHS-OVVQPSECSA-N |
| XLogP | 3.98 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|