C19H14N4O2 — CID 53207883
3-[(2-phenylimidazo[1,2-a]pyrazin-3-yl)amino]benzoic acid (PubChem CID 53207883) has the molecular formula C19H14N4O2 and a molecular weight of 330.35 g/mol. Its IUPAC name is 3-[(2-phenylimidazo[1,2-a]pyrazin-3-yl)amino]benzoic acid.
| Compound Name | 3-[(2-phenylimidazo[1,2-a]pyrazin-3-yl)amino]benzoic acid |
|---|---|
| PubChem CID | 53207883 |
| Molecular Formula | C19H14N4O2 |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | 3-[(2-phenylimidazo[1,2-a]pyrazin-3-yl)amino]benzoic acid |
| SMILES | O=C(O)c1cccc(Nc2c(-c3ccccc3)nc3cnccn23)c1 |
| InChI | InChI=1S/C19H14N4O2/c24-19(25)14-7-4-8-15(11-14)21-18-17(13-5-2-1-3-6-13)22-16-12-20-9-10-23(16)18/h1-12,21H,(H,24,25) |
| InChIKey | XVHKNWKBDPFESY-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 79.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |