C24H26ClN5 — CID 143150792
2-(4-aminophenyl)-N-(3-chlorophenyl)imidazo[1,2-a]pyrazin-3-amine;but-2-yne;ethane (PubChem CID 143150792) has the molecular formula C24H26ClN5 and a molecular weight of 419.96 g/mol. Its IUPAC name is 2-(4-aminophenyl)-N-(3-chlorophenyl)imidazo[1,2-a]pyrazin-3-amine;but-2-yne;ethane.
| Compound Name | 2-(4-aminophenyl)-N-(3-chlorophenyl)imidazo[1,2-a]pyrazin-3-amine;but-2-yne;ethane |
|---|---|
| PubChem CID | 143150792 |
| Molecular Formula | C24H26ClN5 |
| Molecular Weight | 419.96 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | 2-(4-aminophenyl)-N-(3-chlorophenyl)imidazo[1,2-a]pyrazin-3-amine;but-2-yne;ethane |
| SMILES | CC.CC#CC.Nc1ccc(-c2nc3cnccn3c2Nc2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C18H14ClN5.C4H6.C2H6/c19-13-2-1-3-15(10-13)22-18-17(12-4-6-14(20)7-5-12)23-16-11-21-8-9-24(16)18;1-3-4-2;1-2/h1-11,22H,20H2;1-2H3;1-2H3 |
| InChIKey | TUCZMDLXNYXTFM-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 68.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.96 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|