C23H35NO3SSi — CID 90349484
ethyl 3-[[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]amino]-1-benzothiophene-2-carboxylate (PubChem CID 90349484) has the molecular formula C23H35NO3SSi and a molecular weight of 433.69 g/mol. Its IUPAC name is ethyl 3-[[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]amino]-1-benzothiophene-2-carboxylate.
| Compound Name | ethyl 3-[[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]amino]-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 90349484 |
| Molecular Formula | C23H35NO3SSi |
| Molecular Weight | 433.69 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | ethyl 3-[[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]amino]-1-benzothiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc2ccccc2c1NC1CCC(O[Si](C)(C)C(C)(C)C)CC1 |
| InChI | InChI=1S/C23H35NO3SSi/c1-7-26-22(25)21-20(18-10-8-9-11-19(18)28-21)24-16-12-14-17(15-13-16)27-29(5,6)23(2,3)4/h8-11,16-17,24H,7,12-15H2,1-6H3 |
| InChIKey | NXESKPLUYFVLCJ-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.69 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|