C18H19N3O4 — CID 59034023
(4R,7S)-7-(1,3-dioxoisoindol-2-yl)-4-methyl-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-6,10-dione (PubChem CID 59034023) has the molecular formula C18H19N3O4 and a molecular weight of 341.37 g/mol. Its IUPAC name is (4R,7S)-7-(1,3-dioxoisoindol-2-yl)-4-methyl-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-6,10-dione.
| Compound Name | (4R,7S)-7-(1,3-dioxoisoindol-2-yl)-4-methyl-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-6,10-dione |
|---|---|
| PubChem CID | 59034023 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | (4R,7S)-7-(1,3-dioxoisoindol-2-yl)-4-methyl-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-6,10-dione |
| SMILES | C[C@@H]1CCCN2C(=O)CC[C@H](N3C(=O)c4ccccc4C3=O)C(=O)N12 |
| InChI | InChI=1S/C18H19N3O4/c1-11-5-4-10-19-15(22)9-8-14(18(25)21(11)19)20-16(23)12-6-2-3-7-13(12)17(20)24/h2-3,6-7,11,14H,4-5,8-10H2,1H3/t11-,14+/m1/s1 |
| InChIKey | BNGBSIHHGJMNHU-RISCZKNCSA-N |
| XLogP | 1.20 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|