C25H33N3O10 — CID 146161296
3-[2-[2-[2-[2-[[2-(1-methyl-2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (PubChem CID 146161296) has the molecular formula C25H33N3O10 and a molecular weight of 535.55 g/mol. Its IUPAC name is 3-[2-[2-[2-[2-[[2-(1-methyl-2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid.
| Compound Name | 3-[2-[2-[2-[2-[[2-(1-methyl-2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
|---|---|
| PubChem CID | 146161296 |
| Molecular Formula | C25H33N3O10 |
| Molecular Weight | 535.55 g/mol |
| Exact Mass | 535.22 |
| IUPAC Name | 3-[2-[2-[2-[2-[[2-(1-methyl-2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| SMILES | CN1C(=O)CCC(N2C(=O)c3cccc(NCCOCCOCCOCCOCCC(=O)O)c3C2=O)C1=O |
| InChI | InChI=1S/C25H33N3O10/c1-27-20(29)6-5-19(24(27)33)28-23(32)17-3-2-4-18(22(17)25(28)34)26-8-10-36-12-14-38-16-15-37-13-11-35-9-7-21(30)31/h2-4,19,26H,5-16H2,1H3,(H,30,31) |
| InChIKey | MEGLOUBGTITXKH-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 161.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.55 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|