C21H25N3O10S — CID 175467968
2-[4-amino-3-[2-(1-methyl-2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxy-4-oxobutoxy]ethyl methanesulfonate (PubChem CID 175467968) has the molecular formula C21H25N3O10S and a molecular weight of 511.51 g/mol. Its IUPAC name is 2-[4-amino-3-[2-(1-methyl-2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxy-4-oxobutoxy]ethyl methanesulfonate.
| Compound Name | 2-[4-amino-3-[2-(1-methyl-2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxy-4-oxobutoxy]ethyl methanesulfonate |
|---|---|
| PubChem CID | 175467968 |
| Molecular Formula | C21H25N3O10S |
| Molecular Weight | 511.51 g/mol |
| Exact Mass | 511.13 |
| IUPAC Name | 2-[4-amino-3-[2-(1-methyl-2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxy-4-oxobutoxy]ethyl methanesulfonate |
| SMILES | CN1C(=O)CCC(N2C(=O)c3cccc(OC(CCOCCOS(C)(=O)=O)C(N)=O)c3C2=O)C1=O |
| InChI | InChI=1S/C21H25N3O10S/c1-23-16(25)7-6-13(20(23)28)24-19(27)12-4-3-5-14(17(12)21(24)29)34-15(18(22)26)8-9-32-10-11-33-35(2,30)31/h3-5,13,15H,6-11H2,1-2H3,(H2,22,26) |
| InChIKey | NGDNZOXOGYSIOD-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 179.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.51 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|