C27H37N3O10 — CID 153375511
[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl] N-[2-[2-[2-[2-(3-methylbutoxy)ethoxy]ethoxy]ethoxy]ethyl]carbamate (PubChem CID 153375511) has the molecular formula C27H37N3O10 and a molecular weight of 563.60 g/mol. Its IUPAC name is [2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl] N-[2-[2-[2-[2-(3-methylbutoxy)ethoxy]ethoxy]ethoxy]ethyl]carbamate.
| Compound Name | [2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl] N-[2-[2-[2-[2-(3-methylbutoxy)ethoxy]ethoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 153375511 |
| Molecular Formula | C27H37N3O10 |
| Molecular Weight | 563.60 g/mol |
| Exact Mass | 563.25 |
| IUPAC Name | [2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl] N-[2-[2-[2-[2-(3-methylbutoxy)ethoxy]ethoxy]ethoxy]ethyl]carbamate |
| SMILES | CC(C)CCOCCOCCOCCOCCNC(=O)Oc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C27H37N3O10/c1-18(2)8-10-36-12-14-38-16-17-39-15-13-37-11-9-28-27(35)40-21-5-3-4-19-23(21)26(34)30(25(19)33)20-6-7-22(31)29-24(20)32/h3-5,18,20H,6-17H2,1-2H3,(H,28,35)(H,29,31,32) |
| InChIKey | BSLDLCGHNNANCB-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 158.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.60 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|