C27H36N4O10 — CID 171073073
2-methylpropyl N-[2-[2-[2-[3-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]-3-oxopropoxy]ethoxy]ethoxy]ethyl]carbamate (PubChem CID 171073073) has the molecular formula C27H36N4O10 and a molecular weight of 576.60 g/mol. Its IUPAC name is 2-methylpropyl N-[2-[2-[2-[3-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]-3-oxopropoxy]ethoxy]ethoxy]ethyl]carbamate.
| Compound Name | 2-methylpropyl N-[2-[2-[2-[3-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]-3-oxopropoxy]ethoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 171073073 |
| Molecular Formula | C27H36N4O10 |
| Molecular Weight | 576.60 g/mol |
| Exact Mass | 576.24 |
| IUPAC Name | 2-methylpropyl N-[2-[2-[2-[3-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]-3-oxopropoxy]ethoxy]ethoxy]ethyl]carbamate |
| SMILES | CC(C)COC(=O)NCCOCCOCCOCCC(=O)Nc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C27H36N4O10/c1-17(2)16-41-27(37)28-9-11-39-13-15-40-14-12-38-10-8-22(33)29-19-5-3-4-18-23(19)26(36)31(25(18)35)20-6-7-21(32)30-24(20)34/h3-5,17,20H,6-16H2,1-2H3,(H,28,37)(H,29,33)(H,30,32,34) |
| InChIKey | DSESISYUMCHLEO-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 178.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.60 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|