C23H25Cl2NO3S — CID 67754861
2-[4-[(3,4-dichlorophenyl)methyl]-6-hexyl-3-oxo-1,4-benzothiazin-2-yl]acetic acid (PubChem CID 67754861) has the molecular formula C23H25Cl2NO3S and a molecular weight of 466.43 g/mol. Its IUPAC name is 2-[4-[(3,4-dichlorophenyl)methyl]-6-hexyl-3-oxo-1,4-benzothiazin-2-yl]acetic acid.
| Compound Name | 2-[4-[(3,4-dichlorophenyl)methyl]-6-hexyl-3-oxo-1,4-benzothiazin-2-yl]acetic acid |
|---|---|
| PubChem CID | 67754861 |
| Molecular Formula | C23H25Cl2NO3S |
| Molecular Weight | 466.43 g/mol |
| Exact Mass | 465.09 |
| IUPAC Name | 2-[4-[(3,4-dichlorophenyl)methyl]-6-hexyl-3-oxo-1,4-benzothiazin-2-yl]acetic acid |
| SMILES | CCCCCCc1ccc2c(c1)N(Cc1ccc(Cl)c(Cl)c1)C(=O)C(CC(=O)O)S2 |
| InChI | InChI=1S/C23H25Cl2NO3S/c1-2-3-4-5-6-15-8-10-20-19(12-15)26(23(29)21(30-20)13-22(27)28)14-16-7-9-17(24)18(25)11-16/h7-12,21H,2-6,13-14H2,1H3,(H,27,28) |
| InChIKey | GGIMRCHFDCQALW-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.43 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|