C22H23BrFNO3S — CID 54167984
2-[4-[(4-bromo-2-fluorophenyl)methyl]-3-oxo-6-pentyl-1,4-benzothiazin-2-yl]acetic acid (PubChem CID 54167984) has the molecular formula C22H23BrFNO3S and a molecular weight of 480.40 g/mol. Its IUPAC name is 2-[4-[(4-bromo-2-fluorophenyl)methyl]-3-oxo-6-pentyl-1,4-benzothiazin-2-yl]acetic acid.
| Compound Name | 2-[4-[(4-bromo-2-fluorophenyl)methyl]-3-oxo-6-pentyl-1,4-benzothiazin-2-yl]acetic acid |
|---|---|
| PubChem CID | 54167984 |
| Molecular Formula | C22H23BrFNO3S |
| Molecular Weight | 480.40 g/mol |
| Exact Mass | 479.06 |
| IUPAC Name | 2-[4-[(4-bromo-2-fluorophenyl)methyl]-3-oxo-6-pentyl-1,4-benzothiazin-2-yl]acetic acid |
| SMILES | CCCCCc1ccc2c(c1)N(Cc1ccc(Br)cc1F)C(=O)C(CC(=O)O)S2 |
| InChI | InChI=1S/C22H23BrFNO3S/c1-2-3-4-5-14-6-9-19-18(10-14)25(22(28)20(29-19)12-21(26)27)13-15-7-8-16(23)11-17(15)24/h6-11,20H,2-5,12-13H2,1H3,(H,26,27) |
| InChIKey | OSZJLFUBFQFWPK-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.40 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|