C23H27NO3S — CID 54440639
2-[4-[(4-hexylphenyl)methyl]-3-oxo-1,4-benzothiazin-2-yl]acetic acid (PubChem CID 54440639) has the molecular formula C23H27NO3S and a molecular weight of 397.54 g/mol. Its IUPAC name is 2-[4-[(4-hexylphenyl)methyl]-3-oxo-1,4-benzothiazin-2-yl]acetic acid.
| Compound Name | 2-[4-[(4-hexylphenyl)methyl]-3-oxo-1,4-benzothiazin-2-yl]acetic acid |
|---|---|
| PubChem CID | 54440639 |
| Molecular Formula | C23H27NO3S |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | 2-[4-[(4-hexylphenyl)methyl]-3-oxo-1,4-benzothiazin-2-yl]acetic acid |
| SMILES | CCCCCCc1ccc(CN2C(=O)C(CC(=O)O)Sc3ccccc32)cc1 |
| InChI | InChI=1S/C23H27NO3S/c1-2-3-4-5-8-17-11-13-18(14-12-17)16-24-19-9-6-7-10-20(19)28-21(23(24)27)15-22(25)26/h6-7,9-14,21H,2-5,8,15-16H2,1H3,(H,25,26) |
| InChIKey | WNVRWEVKWHNZQG-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|