C16H15NOS2 — CID 177488422
4-benzyl-2-methylsulfanyl-1,4-benzothiazin-3-one (PubChem CID 177488422) has the molecular formula C16H15NOS2 and a molecular weight of 301.44 g/mol. Its IUPAC name is 4-benzyl-2-methylsulfanyl-1,4-benzothiazin-3-one.
| Compound Name | 4-benzyl-2-methylsulfanyl-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 177488422 |
| Molecular Formula | C16H15NOS2 |
| Molecular Weight | 301.44 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | 4-benzyl-2-methylsulfanyl-1,4-benzothiazin-3-one |
| SMILES | CSC1Sc2ccccc2N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C16H15NOS2/c1-19-16-15(18)17(11-12-7-3-2-4-8-12)13-9-5-6-10-14(13)20-16/h2-10,16H,11H2,1H3 |
| InChIKey | WIJIOUCARWNUHF-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.44 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |