C18H23NO3S2 — CID 18754286
2-[5-[(4-hexylphenyl)methyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 18754286) has the molecular formula C18H23NO3S2 and a molecular weight of 365.52 g/mol. Its IUPAC name is 2-[5-[(4-hexylphenyl)methyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[5-[(4-hexylphenyl)methyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 18754286 |
| Molecular Formula | C18H23NO3S2 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | 2-[5-[(4-hexylphenyl)methyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | CCCCCCc1ccc(CC2SC(=S)N(CC(=O)O)C2=O)cc1 |
| InChI | InChI=1S/C18H23NO3S2/c1-2-3-4-5-6-13-7-9-14(10-8-13)11-15-17(22)19(12-16(20)21)18(23)24-15/h7-10,15H,2-6,11-12H2,1H3,(H,20,21) |
| InChIKey | ACQBHWRRQLXOSQ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|