C28H28N2O3S — CID 18830374
4-[[3-benzyl-5-[(4-butylphenyl)methyl]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid (PubChem CID 18830374) has the molecular formula C28H28N2O3S and a molecular weight of 472.61 g/mol. Its IUPAC name is 4-[[3-benzyl-5-[(4-butylphenyl)methyl]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid.
| Compound Name | 4-[[3-benzyl-5-[(4-butylphenyl)methyl]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
|---|---|
| PubChem CID | 18830374 |
| Molecular Formula | C28H28N2O3S |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | 4-[[3-benzyl-5-[(4-butylphenyl)methyl]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
| SMILES | CCCCc1ccc(CC2S/C(=N\c3ccc(C(=O)O)cc3)N(Cc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C28H28N2O3S/c1-2-3-7-20-10-12-21(13-11-20)18-25-26(31)30(19-22-8-5-4-6-9-22)28(34-25)29-24-16-14-23(15-17-24)27(32)33/h4-6,8-17,25H,2-3,7,18-19H2,1H3,(H,32,33)/b29-28- |
| InChIKey | OSYIUJJPBBNCOK-ZIADKAODSA-N |
| XLogP | 6.10 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|