C26H24N2O3S — CID 18830391
4-[[5-[(2-methylphenyl)methyl]-4-oxo-3-(2-phenylethyl)-1,3-thiazolidin-2-ylidene]amino]benzoic acid (PubChem CID 18830391) has the molecular formula C26H24N2O3S and a molecular weight of 444.56 g/mol. Its IUPAC name is 4-[[5-[(2-methylphenyl)methyl]-4-oxo-3-(2-phenylethyl)-1,3-thiazolidin-2-ylidene]amino]benzoic acid.
| Compound Name | 4-[[5-[(2-methylphenyl)methyl]-4-oxo-3-(2-phenylethyl)-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
|---|---|
| PubChem CID | 18830391 |
| Molecular Formula | C26H24N2O3S |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | 4-[[5-[(2-methylphenyl)methyl]-4-oxo-3-(2-phenylethyl)-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
| SMILES | Cc1ccccc1CC1S/C(=N\c2ccc(C(=O)O)cc2)N(CCc2ccccc2)C1=O |
| InChI | InChI=1S/C26H24N2O3S/c1-18-7-5-6-10-21(18)17-23-24(29)28(16-15-19-8-3-2-4-9-19)26(32-23)27-22-13-11-20(12-14-22)25(30)31/h2-14,23H,15-17H2,1H3,(H,30,31)/b27-26- |
| InChIKey | ZHBUQMXLVIGPOM-RQZHXJHFSA-N |
| XLogP | 5.11 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|