C22H23N3O5S — CID 3581859
4-[[2-[3-(4-hydroxybutyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-yl]acetyl]amino]benzoic acid (PubChem CID 3581859) has the molecular formula C22H23N3O5S and a molecular weight of 441.51 g/mol. Its IUPAC name is 4-[[2-[3-(4-hydroxybutyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-yl]acetyl]amino]benzoic acid.
| Compound Name | 4-[[2-[3-(4-hydroxybutyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-yl]acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 3581859 |
| Molecular Formula | C22H23N3O5S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | 4-[[2-[3-(4-hydroxybutyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-yl]acetyl]amino]benzoic acid |
| SMILES | O=C(CC1S/C(=N\c2ccccc2)N(CCCCO)C1=O)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C22H23N3O5S/c26-13-5-4-12-25-20(28)18(31-22(25)24-16-6-2-1-3-7-16)14-19(27)23-17-10-8-15(9-11-17)21(29)30/h1-3,6-11,18,26H,4-5,12-14H2,(H,23,27)(H,29,30)/b24-22- |
| InChIKey | SEUUUZPWUGSVIQ-GYHWCHFESA-N |
| XLogP | 3.12 |
| TPSA | 119.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|