C28H28Br3NO6 — CID 160888133
1,4-bis(bromomethyl)-2,5-dimethoxybenzene;2-[[4-(bromomethyl)-2,5-dimethoxyphenyl]methyl]isoindole-1,3-dione (PubChem CID 160888133) has the molecular formula C28H28Br3NO6 and a molecular weight of 714.24 g/mol. Its IUPAC name is 1,4-bis(bromomethyl)-2,5-dimethoxybenzene;2-[[4-(bromomethyl)-2,5-dimethoxyphenyl]methyl]isoindole-1,3-dione.
| Compound Name | 1,4-bis(bromomethyl)-2,5-dimethoxybenzene;2-[[4-(bromomethyl)-2,5-dimethoxyphenyl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 160888133 |
| Molecular Formula | C28H28Br3NO6 |
| Molecular Weight | 714.24 g/mol |
| Exact Mass | 710.95 |
| IUPAC Name | 1,4-bis(bromomethyl)-2,5-dimethoxybenzene;2-[[4-(bromomethyl)-2,5-dimethoxyphenyl]methyl]isoindole-1,3-dione |
| SMILES | COc1cc(CBr)c(OC)cc1CBr.COc1cc(CN2C(=O)c3ccccc3C2=O)c(OC)cc1CBr |
| InChI | InChI=1S/C18H16BrNO4.C10H12Br2O2/c1-23-15-8-12(16(24-2)7-11(15)9-19)10-20-17(21)13-5-3-4-6-14(13)18(20)22;1-13-9-3-8(6-12)10(14-2)4-7(9)5-11/h3-8H,9-10H2,1-2H3;3-4H,5-6H2,1-2H3 |
| InChIKey | SNXHYGRZQSMPBQ-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.24 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|