C22H18N2O5S — CID 1298364
N-[3-[(1,3-dioxoisoindol-2-yl)methyl]-4-methoxyphenyl]benzenesulfonamide (PubChem CID 1298364) has the molecular formula C22H18N2O5S and a molecular weight of 422.46 g/mol. Its IUPAC name is N-[3-[(1,3-dioxoisoindol-2-yl)methyl]-4-methoxyphenyl]benzenesulfonamide.
| Compound Name | N-[3-[(1,3-dioxoisoindol-2-yl)methyl]-4-methoxyphenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 1298364 |
| Molecular Formula | C22H18N2O5S |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | N-[3-[(1,3-dioxoisoindol-2-yl)methyl]-4-methoxyphenyl]benzenesulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccccc2)cc1CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H18N2O5S/c1-29-20-12-11-16(23-30(27,28)17-7-3-2-4-8-17)13-15(20)14-24-21(25)18-9-5-6-10-19(18)22(24)26/h2-13,23H,14H2,1H3 |
| InChIKey | ZYKDFLVHFKTZGA-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|