C17H18BrNO4 — CID 42988070
2-[(4-bromo-2,5-dimethoxyphenyl)methyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 42988070) has the molecular formula C17H18BrNO4 and a molecular weight of 380.24 g/mol. Its IUPAC name is 2-[(4-bromo-2,5-dimethoxyphenyl)methyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | 2-[(4-bromo-2,5-dimethoxyphenyl)methyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 42988070 |
| Molecular Formula | C17H18BrNO4 |
| Molecular Weight | 380.24 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | 2-[(4-bromo-2,5-dimethoxyphenyl)methyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | COc1cc(CN2C(=O)C3CC=CCC3C2=O)c(OC)cc1Br |
| InChI | InChI=1S/C17H18BrNO4/c1-22-14-8-13(18)15(23-2)7-10(14)9-19-16(20)11-5-3-4-6-12(11)17(19)21/h3-4,7-8,11-12H,5-6,9H2,1-2H3 |
| InChIKey | AZHWYEGHFUKUEJ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.24 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|