C15H17BrN2O5 — CID 8626674
1-[(4-bromo-2,5-dimethoxyphenyl)methyl]-3-propylimidazolidine-2,4,5-trione (PubChem CID 8626674) has the molecular formula C15H17BrN2O5 and a molecular weight of 385.21 g/mol. Its IUPAC name is 1-[(4-bromo-2,5-dimethoxyphenyl)methyl]-3-propylimidazolidine-2,4,5-trione.
| Compound Name | 1-[(4-bromo-2,5-dimethoxyphenyl)methyl]-3-propylimidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 8626674 |
| Molecular Formula | C15H17BrN2O5 |
| Molecular Weight | 385.21 g/mol |
| Exact Mass | 384.03 |
| IUPAC Name | 1-[(4-bromo-2,5-dimethoxyphenyl)methyl]-3-propylimidazolidine-2,4,5-trione |
| SMILES | CCCN1C(=O)C(=O)N(Cc2cc(OC)c(Br)cc2OC)C1=O |
| InChI | InChI=1S/C15H17BrN2O5/c1-4-5-17-13(19)14(20)18(15(17)21)8-9-6-12(23-3)10(16)7-11(9)22-2/h6-7H,4-5,8H2,1-3H3 |
| InChIKey | IVGGSYQCLUDTPY-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.21 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|