C18H23N3O7 — CID 8627196
N-[(2,4,5-trimethoxyphenyl)methyl]-2-(2,4,5-trioxo-3-propylimidazolidin-1-yl)acetamide (PubChem CID 8627196) has the molecular formula C18H23N3O7 and a molecular weight of 393.40 g/mol. Its IUPAC name is N-[(2,4,5-trimethoxyphenyl)methyl]-2-(2,4,5-trioxo-3-propylimidazolidin-1-yl)acetamide.
| Compound Name | N-[(2,4,5-trimethoxyphenyl)methyl]-2-(2,4,5-trioxo-3-propylimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 8627196 |
| Molecular Formula | C18H23N3O7 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | N-[(2,4,5-trimethoxyphenyl)methyl]-2-(2,4,5-trioxo-3-propylimidazolidin-1-yl)acetamide |
| SMILES | CCCN1C(=O)C(=O)N(CC(=O)NCc2cc(OC)c(OC)cc2OC)C1=O |
| InChI | InChI=1S/C18H23N3O7/c1-5-6-20-16(23)17(24)21(18(20)25)10-15(22)19-9-11-7-13(27-3)14(28-4)8-12(11)26-2/h7-8H,5-6,9-10H2,1-4H3,(H,19,22) |
| InChIKey | JIXQPJFXMVYHSJ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|