C21H21NO4 — CID 2966288
2-[3-(2-methoxy-4-prop-2-enylphenoxy)propyl]isoindole-1,3-dione (PubChem CID 2966288) has the molecular formula C21H21NO4 and a molecular weight of 351.40 g/mol. Its IUPAC name is 2-[3-(2-methoxy-4-prop-2-enylphenoxy)propyl]isoindole-1,3-dione.
| Compound Name | 2-[3-(2-methoxy-4-prop-2-enylphenoxy)propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 2966288 |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | 2-[3-(2-methoxy-4-prop-2-enylphenoxy)propyl]isoindole-1,3-dione |
| SMILES | C=CCc1ccc(OCCCN2C(=O)c3ccccc3C2=O)c(OC)c1 |
| InChI | InChI=1S/C21H21NO4/c1-3-7-15-10-11-18(19(14-15)25-2)26-13-6-12-22-20(23)16-8-4-5-9-17(16)21(22)24/h3-5,8-11,14H,1,6-7,12-13H2,2H3 |
| InChIKey | CCSKLQHZRWPIMR-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|