C22H26N2O3 — CID 71670984
5-[2-(2-methoxy-4-prop-2-enylphenoxy)ethyl]-3-methyl-2,3-dihydro-1H-1,5-benzodiazepin-4-one (PubChem CID 71670984) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is 5-[2-(2-methoxy-4-prop-2-enylphenoxy)ethyl]-3-methyl-2,3-dihydro-1H-1,5-benzodiazepin-4-one.
| Compound Name | 5-[2-(2-methoxy-4-prop-2-enylphenoxy)ethyl]-3-methyl-2,3-dihydro-1H-1,5-benzodiazepin-4-one |
|---|---|
| PubChem CID | 71670984 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 5-[2-(2-methoxy-4-prop-2-enylphenoxy)ethyl]-3-methyl-2,3-dihydro-1H-1,5-benzodiazepin-4-one |
| SMILES | C=CCc1ccc(OCCN2C(=O)C(C)CNc3ccccc32)c(OC)c1 |
| InChI | InChI=1S/C22H26N2O3/c1-4-7-17-10-11-20(21(14-17)26-3)27-13-12-24-19-9-6-5-8-18(19)23-15-16(2)22(24)25/h4-6,8-11,14,16,23H,1,7,12-13,15H2,2-3H3 |
| InChIKey | HBZKTGFCVRJEJM-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|