C25H29ClN2O5 — CID 46927983
2-[10-(5-chloro-2-methyl-4-nitrophenoxy)decyl]isoindole-1,3-dione (PubChem CID 46927983) has the molecular formula C25H29ClN2O5 and a molecular weight of 472.97 g/mol. Its IUPAC name is 2-[10-(5-chloro-2-methyl-4-nitrophenoxy)decyl]isoindole-1,3-dione.
| Compound Name | 2-[10-(5-chloro-2-methyl-4-nitrophenoxy)decyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 46927983 |
| Molecular Formula | C25H29ClN2O5 |
| Molecular Weight | 472.97 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | 2-[10-(5-chloro-2-methyl-4-nitrophenoxy)decyl]isoindole-1,3-dione |
| SMILES | Cc1cc([N+](=O)[O-])c(Cl)cc1OCCCCCCCCCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C25H29ClN2O5/c1-18-16-22(28(31)32)21(26)17-23(18)33-15-11-7-5-3-2-4-6-10-14-27-24(29)19-12-8-9-13-20(19)25(27)30/h8-9,12-13,16-17H,2-7,10-11,14-15H2,1H3 |
| InChIKey | NYOSDXZSNLVXHN-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.97 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|