C23H31NO3 — CID 174546939
ethyl 2-[2-(aminomethyl)-4-[3-(4-hydroxy-3-methylphenyl)pentan-3-yl]phenyl]acetate (PubChem CID 174546939) has the molecular formula C23H31NO3 and a molecular weight of 369.51 g/mol. Its IUPAC name is ethyl 2-[2-(aminomethyl)-4-[3-(4-hydroxy-3-methylphenyl)pentan-3-yl]phenyl]acetate.
| Compound Name | ethyl 2-[2-(aminomethyl)-4-[3-(4-hydroxy-3-methylphenyl)pentan-3-yl]phenyl]acetate |
|---|---|
| PubChem CID | 174546939 |
| Molecular Formula | C23H31NO3 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | ethyl 2-[2-(aminomethyl)-4-[3-(4-hydroxy-3-methylphenyl)pentan-3-yl]phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(C(CC)(CC)c2ccc(O)c(C)c2)cc1CN |
| InChI | InChI=1S/C23H31NO3/c1-5-23(6-2,19-10-11-21(25)16(4)12-19)20-9-8-17(18(13-20)15-24)14-22(26)27-7-3/h8-13,25H,5-7,14-15,24H2,1-4H3 |
| InChIKey | LBBZMOPHEVGWNZ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |