C24H34N2O3 — CID 174495941
ethyl 3-[2-(aminomethyl)-4-[3-[3-(aminomethyl)-4-hydroxyphenyl]pentan-3-yl]phenyl]propanoate (PubChem CID 174495941) has the molecular formula C24H34N2O3 and a molecular weight of 398.55 g/mol. Its IUPAC name is ethyl 3-[2-(aminomethyl)-4-[3-[3-(aminomethyl)-4-hydroxyphenyl]pentan-3-yl]phenyl]propanoate.
| Compound Name | ethyl 3-[2-(aminomethyl)-4-[3-[3-(aminomethyl)-4-hydroxyphenyl]pentan-3-yl]phenyl]propanoate |
|---|---|
| PubChem CID | 174495941 |
| Molecular Formula | C24H34N2O3 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.26 |
| IUPAC Name | ethyl 3-[2-(aminomethyl)-4-[3-[3-(aminomethyl)-4-hydroxyphenyl]pentan-3-yl]phenyl]propanoate |
| SMILES | CCOC(=O)CCc1ccc(C(CC)(CC)c2ccc(O)c(CN)c2)cc1CN |
| InChI | InChI=1S/C24H34N2O3/c1-4-24(5-2,21-10-11-22(27)19(14-21)16-26)20-9-7-17(18(13-20)15-25)8-12-23(28)29-6-3/h7,9-11,13-14,27H,4-6,8,12,15-16,25-26H2,1-3H3 |
| InChIKey | FLZFYNZAQBZJJR-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 98.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|