C35H43N3O2 — CID 135804512
4-[4,6-bis(4-tert-butylphenyl)-1,3,5-triazin-2-yl]-6-hexylbenzene-1,3-diol (PubChem CID 135804512) has the molecular formula C35H43N3O2 and a molecular weight of 537.75 g/mol. Its IUPAC name is 4-[4,6-bis(4-tert-butylphenyl)-1,3,5-triazin-2-yl]-6-hexylbenzene-1,3-diol.
| Compound Name | 4-[4,6-bis(4-tert-butylphenyl)-1,3,5-triazin-2-yl]-6-hexylbenzene-1,3-diol |
|---|---|
| PubChem CID | 135804512 |
| Molecular Formula | C35H43N3O2 |
| Molecular Weight | 537.75 g/mol |
| Exact Mass | 537.34 |
| IUPAC Name | 4-[4,6-bis(4-tert-butylphenyl)-1,3,5-triazin-2-yl]-6-hexylbenzene-1,3-diol |
| SMILES | CCCCCCc1cc(-c2nc(-c3ccc(C(C)(C)C)cc3)nc(-c3ccc(C(C)(C)C)cc3)n2)c(O)cc1O |
| InChI | InChI=1S/C35H43N3O2/c1-8-9-10-11-12-25-21-28(30(40)22-29(25)39)33-37-31(23-13-17-26(18-14-23)34(2,3)4)36-32(38-33)24-15-19-27(20-16-24)35(5,6)7/h13-22,39-40H,8-12H2,1-7H3 |
| InChIKey | SFZFMJCSZIPXAB-UHFFFAOYSA-N |
| XLogP | 9.00 |
| TPSA | 79.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.75 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|