C28H37N3O4 — CID 135723535
5-(3-butoxy-2-hydroxypropoxy)-4-hexyl-2-(4-phenyl-1,3,5-triazin-2-yl)phenol (PubChem CID 135723535) has the molecular formula C28H37N3O4 and a molecular weight of 479.62 g/mol. Its IUPAC name is 5-(3-butoxy-2-hydroxypropoxy)-4-hexyl-2-(4-phenyl-1,3,5-triazin-2-yl)phenol.
| Compound Name | 5-(3-butoxy-2-hydroxypropoxy)-4-hexyl-2-(4-phenyl-1,3,5-triazin-2-yl)phenol |
|---|---|
| PubChem CID | 135723535 |
| Molecular Formula | C28H37N3O4 |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.28 |
| IUPAC Name | 5-(3-butoxy-2-hydroxypropoxy)-4-hexyl-2-(4-phenyl-1,3,5-triazin-2-yl)phenol |
| SMILES | CCCCCCc1cc(-c2ncnc(-c3ccccc3)n2)c(O)cc1OCC(O)COCCCC |
| InChI | InChI=1S/C28H37N3O4/c1-3-5-7-9-14-22-16-24(28-30-20-29-27(31-28)21-12-10-8-11-13-21)25(33)17-26(22)35-19-23(32)18-34-15-6-4-2/h8,10-13,16-17,20,23,32-33H,3-7,9,14-15,18-19H2,1-2H3 |
| InChIKey | TXAHJRYMOBKKHM-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 97.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|