C44H43N3O4 — CID 141485933
[2-[4-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-3-hydroxyphenoxy]-6-methylheptyl] propanoate (PubChem CID 141485933) has the molecular formula C44H43N3O4 and a molecular weight of 677.85 g/mol. Its IUPAC name is [2-[4-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-3-hydroxyphenoxy]-6-methylheptyl] propanoate.
| Compound Name | [2-[4-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-3-hydroxyphenoxy]-6-methylheptyl] propanoate |
|---|---|
| PubChem CID | 141485933 |
| Molecular Formula | C44H43N3O4 |
| Molecular Weight | 677.85 g/mol |
| Exact Mass | 677.33 |
| IUPAC Name | [2-[4-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-3-hydroxyphenoxy]-6-methylheptyl] propanoate |
| SMILES | CCC(=O)OCC(CCCC(C)C)Oc1ccc(-c2nc(-c3ccc(-c4ccccc4)cc3)nc(-c3ccc(-c4ccccc4)cc3)n2)c(O)c1 |
| InChI | InChI=1S/C44H43N3O4/c1-4-41(49)50-29-38(17-11-12-30(2)3)51-37-26-27-39(40(48)28-37)44-46-42(35-22-18-33(19-23-35)31-13-7-5-8-14-31)45-43(47-44)36-24-20-34(21-25-36)32-15-9-6-10-16-32/h5-10,13-16,18-28,30,38,48H,4,11-12,17,29H2,1-3H3 |
| InChIKey | NGAGROFHQFZBRT-UHFFFAOYSA-N |
| XLogP | 10.44 |
| TPSA | 94.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.85 |
| LogP ≤ 5 | 10.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |